C23H38N2OS — CID 144600244
ethane;methanamine;(E)-3-[2-methyl-5-[(3E)-6-methyl-5-sulfanyloxyhepta-1,3,5-trien-3-yl]phenyl]pent-3-en-2-amine (PubChem CID 144600244) has the molecular formula C23H38N2OS and a molecular weight of 390.64 g/mol. Its IUPAC name is ethane;methanamine;(E)-3-[2-methyl-5-[(3E)-6-methyl-5-sulfanyloxyhepta-1,3,5-trien-3-yl]phenyl]pent-3-en-2-amine.
| Compound Name | ethane;methanamine;(E)-3-[2-methyl-5-[(3E)-6-methyl-5-sulfanyloxyhepta-1,3,5-trien-3-yl]phenyl]pent-3-en-2-amine |
|---|---|
| PubChem CID | 144600244 |
| Molecular Formula | C23H38N2OS |
| Molecular Weight | 390.64 g/mol |
| Exact Mass | 390.27 |
| IUPAC Name | ethane;methanamine;(E)-3-[2-methyl-5-[(3E)-6-methyl-5-sulfanyloxyhepta-1,3,5-trien-3-yl]phenyl]pent-3-en-2-amine |
| SMILES | C=C/C(=C\C(OS)=C(C)C)c1ccc(C)c(/C(=C\C)C(C)N)c1.CC.CN |
| InChI | InChI=1S/C20H27NOS.C2H6.CH5N/c1-7-16(12-20(22-23)13(3)4)17-10-9-14(5)19(11-17)18(8-2)15(6)21;2*1-2/h7-12,15,23H,1,21H2,2-6H3;1-2H3;2H2,1H3/b16-12+,18-8-;; |
| InChIKey | WHQRPPICTTVAGQ-GZQPMSJUSA-N |
| XLogP | 6.07 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.64 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|