C17H31F5N2O2 — CID 144600535
N-fluoro-2,4-dimethyl-6-[3-(trifluoromethyl)piperidin-1-yl]hexanamide;propan-2-yl hypofluorite (PubChem CID 144600535) has the molecular formula C17H31F5N2O2 and a molecular weight of 390.44 g/mol. Its IUPAC name is N-fluoro-2,4-dimethyl-6-[3-(trifluoromethyl)piperidin-1-yl]hexanamide;propan-2-yl hypofluorite.
| Compound Name | N-fluoro-2,4-dimethyl-6-[3-(trifluoromethyl)piperidin-1-yl]hexanamide;propan-2-yl hypofluorite |
|---|---|
| PubChem CID | 144600535 |
| Molecular Formula | C17H31F5N2O2 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | N-fluoro-2,4-dimethyl-6-[3-(trifluoromethyl)piperidin-1-yl]hexanamide;propan-2-yl hypofluorite |
| SMILES | CC(C)OF.CC(CCN1CCCC(C(F)(F)F)C1)CC(C)C(=O)NF |
| InChI | InChI=1S/C14H24F4N2O.C3H7FO/c1-10(8-11(2)13(21)19-18)5-7-20-6-3-4-12(9-20)14(15,16)17;1-3(2)5-4/h10-12H,3-9H2,1-2H3,(H,19,21);3H,1-2H3 |
| InChIKey | DFZNFGKJCADHBT-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|