About 2-fluoro-9,10-dihydroacridine
2-fluoro-9,10-dihydroacridine (PubChem CID 14460071) has the molecular formula C13H10FN
and a molecular weight of 199.23 g/mol. Its IUPAC name is 2-fluoro-9,10-dihydroacridine.
Molecular Properties
| Compound Name | 2-fluoro-9,10-dihydroacridine |
| PubChem CID | 14460071 |
| Molecular Formula | C13H10FN |
| Molecular Weight | 199.23 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 2-fluoro-9,10-dihydroacridine |
| SMILES | Fc1ccc2c(c1)Cc1ccccc1N2 |
| InChI | InChI=1S/C13H10FN/c14-11-5-6-13-10(8-11)7-9-3-1-2-4-12(9)15-13/h1-6,8,15H,7H2 |
| InChIKey | VYKPBOHCOSBOJP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.23 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-fluoro-9,10-dihydroacridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-9,10-dihydroacridine?
The IUPAC name of 2-fluoro-9,10-dihydroacridine (CID 14460071) is 2-fluoro-9,10-dihydroacridine.
What is the SMILES notation for 2-fluoro-9,10-dihydroacridine?
The canonical SMILES for 2-fluoro-9,10-dihydroacridine is Fc1ccc2c(c1)Cc1ccccc1N2.
What is the InChIKey of 2-fluoro-9,10-dihydroacridine?
The InChIKey is VYKPBOHCOSBOJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10FN/c14-11-5-6-13-10(8-11)7-9-3-1-2-4-12(9)15-13/h1-6,8,15H,7H2.
What are the key properties of 2-fluoro-9,10-dihydroacridine?
2-fluoro-9,10-dihydroacridine has a molecular weight of 199.23 g/mol, XLogP of 3.47, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-9,10-dihydroacridine is sourced from PubChem (CID 14460071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).