C35H21ClN4 — CID 144600879
4-[2-chloro-6-[4-(9-phenylcarbazol-3-yl)phenyl]pyrimidin-4-yl]benzonitrile (PubChem CID 144600879) has the molecular formula C35H21ClN4 and a molecular weight of 533.03 g/mol. Its IUPAC name is 4-[2-chloro-6-[4-(9-phenylcarbazol-3-yl)phenyl]pyrimidin-4-yl]benzonitrile.
| Compound Name | 4-[2-chloro-6-[4-(9-phenylcarbazol-3-yl)phenyl]pyrimidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 144600879 |
| Molecular Formula | C35H21ClN4 |
| Molecular Weight | 533.03 g/mol |
| Exact Mass | 532.15 |
| IUPAC Name | 4-[2-chloro-6-[4-(9-phenylcarbazol-3-yl)phenyl]pyrimidin-4-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2cc(-c3ccc(-c4ccc5c(c4)c4ccccc4n5-c4ccccc4)cc3)nc(Cl)n2)cc1 |
| InChI | InChI=1S/C35H21ClN4/c36-35-38-31(25-12-10-23(22-37)11-13-25)21-32(39-35)26-16-14-24(15-17-26)27-18-19-34-30(20-27)29-8-4-5-9-33(29)40(34)28-6-2-1-3-7-28/h1-21H |
| InChIKey | IZARCUWCOYYFAW-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.03 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |