About ethane;4-(1H-indol-5-yl)-7,8-dihydroisoquinoline
ethane;4-(1H-indol-5-yl)-7,8-dihydroisoquinoline (PubChem CID 144601880) has the molecular formula C19H20N2
and a molecular weight of 276.38 g/mol. Its IUPAC name is ethane;4-(1H-indol-5-yl)-7,8-dihydroisoquinoline.
Molecular Properties
| Compound Name | ethane;4-(1H-indol-5-yl)-7,8-dihydroisoquinoline |
| PubChem CID | 144601880 |
| Molecular Formula | C19H20N2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | ethane;4-(1H-indol-5-yl)-7,8-dihydroisoquinoline |
| SMILES | C1=Cc2c(cncc2-c2ccc3[nH]ccc3c2)CC1.CC |
| InChI | InChI=1S/C17H14N2.C2H6/c1-2-4-15-14(3-1)10-18-11-16(15)12-5-6-17-13(9-12)7-8-19-17;1-2/h2,4-11,19H,1,3H2;1-2H3 |
| InChIKey | RIVLUHVYYCCJHC-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;4-(1H-indol-5-yl)-7,8-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-(1H-indol-5-yl)-7,8-dihydroisoquinoline?
The IUPAC name of ethane;4-(1H-indol-5-yl)-7,8-dihydroisoquinoline (CID 144601880) is ethane;4-(1H-indol-5-yl)-7,8-dihydroisoquinoline.
What is the SMILES notation for ethane;4-(1H-indol-5-yl)-7,8-dihydroisoquinoline?
The canonical SMILES for ethane;4-(1H-indol-5-yl)-7,8-dihydroisoquinoline is C1=Cc2c(cncc2-c2ccc3[nH]ccc3c2)CC1.CC.
What is the InChIKey of ethane;4-(1H-indol-5-yl)-7,8-dihydroisoquinoline?
The InChIKey is RIVLUHVYYCCJHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2.C2H6/c1-2-4-15-14(3-1)10-18-11-16(15)12-5-6-17-13(9-12)7-8-19-17;1-2/h2,4-11,19H,1,3H2;1-2H3.
What are the key properties of ethane;4-(1H-indol-5-yl)-7,8-dihydroisoquinoline?
ethane;4-(1H-indol-5-yl)-7,8-dihydroisoquinoline has a molecular weight of 276.38 g/mol, XLogP of 5.22, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-(1H-indol-5-yl)-7,8-dihydroisoquinoline is sourced from PubChem (CID 144601880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).