C26H37N — CID 144602137
ethane;3-[(2Z,4Z)-2-(3-ethylphenyl)hepta-2,4-dien-3-yl]-7-azabicyclo[4.2.0]octa-1(6),2,4-triene (PubChem CID 144602137) has the molecular formula C26H37N and a molecular weight of 363.59 g/mol. Its IUPAC name is ethane;3-[(2Z,4Z)-2-(3-ethylphenyl)hepta-2,4-dien-3-yl]-7-azabicyclo[4.2.0]octa-1(6),2,4-triene.
| Compound Name | ethane;3-[(2Z,4Z)-2-(3-ethylphenyl)hepta-2,4-dien-3-yl]-7-azabicyclo[4.2.0]octa-1(6),2,4-triene |
|---|---|
| PubChem CID | 144602137 |
| Molecular Formula | C26H37N |
| Molecular Weight | 363.59 g/mol |
| Exact Mass | 363.29 |
| IUPAC Name | ethane;3-[(2Z,4Z)-2-(3-ethylphenyl)hepta-2,4-dien-3-yl]-7-azabicyclo[4.2.0]octa-1(6),2,4-triene |
| SMILES | CC.CC.CC/C=C\C(=C(/C)c1cccc(CC)c1)c1ccc2c(c1)CN2 |
| InChI | InChI=1S/C22H25N.2C2H6/c1-4-6-10-21(19-11-12-22-20(14-19)15-23-22)16(3)18-9-7-8-17(5-2)13-18;2*1-2/h6-14,23H,4-5,15H2,1-3H3;2*1-2H3/b10-6-,21-16-;; |
| InChIKey | NFBDWFQYESIVJD-PVPGEHJGSA-N |
| XLogP | 8.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.59 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|