About 2-methoxy-6,9-dimethylpurine
2-methoxy-6,9-dimethylpurine (PubChem CID 144602702) has the molecular formula C8H10N4O
and a molecular weight of 178.19 g/mol. Its IUPAC name is 2-methoxy-6,9-dimethylpurine.
Molecular Properties
| Compound Name | 2-methoxy-6,9-dimethylpurine |
| PubChem CID | 144602702 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 2-methoxy-6,9-dimethylpurine |
| SMILES | COc1nc(C)c2ncn(C)c2n1 |
| InChI | InChI=1S/C8H10N4O/c1-5-6-7(12(2)4-9-6)11-8(10-5)13-3/h4H,1-3H3 |
| InChIKey | GSYZZWCWPPNXPD-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methoxy-6,9-dimethylpurine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-6,9-dimethylpurine?
The IUPAC name of 2-methoxy-6,9-dimethylpurine (CID 144602702) is 2-methoxy-6,9-dimethylpurine.
What is the SMILES notation for 2-methoxy-6,9-dimethylpurine?
The canonical SMILES for 2-methoxy-6,9-dimethylpurine is COc1nc(C)c2ncn(C)c2n1.
What is the InChIKey of 2-methoxy-6,9-dimethylpurine?
The InChIKey is GSYZZWCWPPNXPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O/c1-5-6-7(12(2)4-9-6)11-8(10-5)13-3/h4H,1-3H3.
What are the key properties of 2-methoxy-6,9-dimethylpurine?
2-methoxy-6,9-dimethylpurine has a molecular weight of 178.19 g/mol, XLogP of 0.68, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-6,9-dimethylpurine is sourced from PubChem (CID 144602702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).