About ethyl (2R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoro-2-methylpropanoate
ethyl (2R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoro-2-methylpropanoate (PubChem CID 144602734) has the molecular formula C11H19FO4
and a molecular weight of 234.27 g/mol. Its IUPAC name is ethyl (2R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoro-2-methylpropanoate.
Molecular Properties
| Compound Name | ethyl (2R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoro-2-methylpropanoate |
| PubChem CID | 144602734 |
| Molecular Formula | C11H19FO4 |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | ethyl (2R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoro-2-methylpropanoate |
| SMILES | CCOC(=O)[C@](C)(F)C[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C11H19FO4/c1-5-14-9(13)11(4,12)6-8-7-15-10(2,3)16-8/h8H,5-7H2,1-4H3/t8-,11+/m0/s1 |
| InChIKey | QJGYGDYGNBDVFZ-GZMMTYOYSA-N |
| XLogP | 1.82 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl (2R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoro-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoro-2-methylpropanoate?
The IUPAC name of ethyl (2R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoro-2-methylpropanoate (CID 144602734) is ethyl (2R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoro-2-methylpropanoate.
What is the SMILES notation for ethyl (2R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoro-2-methylpropanoate?
The canonical SMILES for ethyl (2R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoro-2-methylpropanoate is CCOC(=O)[C@](C)(F)C[C@H]1COC(C)(C)O1.
What is the InChIKey of ethyl (2R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoro-2-methylpropanoate?
The InChIKey is QJGYGDYGNBDVFZ-GZMMTYOYSA-N. The full InChI is InChI=1S/C11H19FO4/c1-5-14-9(13)11(4,12)6-8-7-15-10(2,3)16-8/h8H,5-7H2,1-4H3/t8-,11+/m0/s1.
What are the key properties of ethyl (2R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoro-2-methylpropanoate?
ethyl (2R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoro-2-methylpropanoate has a molecular weight of 234.27 g/mol, XLogP of 1.82, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoro-2-methylpropanoate is sourced from PubChem (CID 144602734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).