C23H27F3N2O3 — CID 144603112
2,2,2-trifluoro-1-[1-[4-[(3R)-1-(4-propan-2-yloxyphenyl)pyrrolidin-3-yl]oxyphenyl]ethenylamino]ethanol (PubChem CID 144603112) has the molecular formula C23H27F3N2O3 and a molecular weight of 436.47 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[1-[4-[(3R)-1-(4-propan-2-yloxyphenyl)pyrrolidin-3-yl]oxyphenyl]ethenylamino]ethanol.
| Compound Name | 2,2,2-trifluoro-1-[1-[4-[(3R)-1-(4-propan-2-yloxyphenyl)pyrrolidin-3-yl]oxyphenyl]ethenylamino]ethanol |
|---|---|
| PubChem CID | 144603112 |
| Molecular Formula | C23H27F3N2O3 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 2,2,2-trifluoro-1-[1-[4-[(3R)-1-(4-propan-2-yloxyphenyl)pyrrolidin-3-yl]oxyphenyl]ethenylamino]ethanol |
| SMILES | C=C(NC(O)C(F)(F)F)c1ccc(O[C@@H]2CCN(c3ccc(OC(C)C)cc3)C2)cc1 |
| InChI | InChI=1S/C23H27F3N2O3/c1-15(2)30-19-10-6-18(7-11-19)28-13-12-21(14-28)31-20-8-4-17(5-9-20)16(3)27-22(29)23(24,25)26/h4-11,15,21-22,27,29H,3,12-14H2,1-2H3/t21-,22?/m1/s1 |
| InChIKey | UHXPRLUEWZZHPP-ZMFCMNQTSA-N |
| XLogP | 4.57 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|