About cyclopentane;ethane;4-[1-(ethenylamino)ethyl]phenol
cyclopentane;ethane;4-[1-(ethenylamino)ethyl]phenol (PubChem CID 144603163) has the molecular formula C19H35NO
and a molecular weight of 293.50 g/mol. Its IUPAC name is cyclopentane;ethane;4-[1-(ethenylamino)ethyl]phenol.
Molecular Properties
| Compound Name | cyclopentane;ethane;4-[1-(ethenylamino)ethyl]phenol |
| PubChem CID | 144603163 |
| Molecular Formula | C19H35NO |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.27 |
| IUPAC Name | cyclopentane;ethane;4-[1-(ethenylamino)ethyl]phenol |
| SMILES | C1CCCC1.C=CNC(C)c1ccc(O)cc1.CC.CC |
| InChI | InChI=1S/C10H13NO.C5H10.2C2H6/c1-3-11-8(2)9-4-6-10(12)7-5-9;1-2-4-5-3-1;2*1-2/h3-8,11-12H,1H2,2H3;1-5H2;2*1-2H3 |
| InChIKey | AFEIZSSLAHKQRL-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopentane;ethane;4-[1-(ethenylamino)ethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentane;ethane;4-[1-(ethenylamino)ethyl]phenol?
The IUPAC name of cyclopentane;ethane;4-[1-(ethenylamino)ethyl]phenol (CID 144603163) is cyclopentane;ethane;4-[1-(ethenylamino)ethyl]phenol.
What is the SMILES notation for cyclopentane;ethane;4-[1-(ethenylamino)ethyl]phenol?
The canonical SMILES for cyclopentane;ethane;4-[1-(ethenylamino)ethyl]phenol is C1CCCC1.C=CNC(C)c1ccc(O)cc1.CC.CC.
What is the InChIKey of cyclopentane;ethane;4-[1-(ethenylamino)ethyl]phenol?
The InChIKey is AFEIZSSLAHKQRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO.C5H10.2C2H6/c1-3-11-8(2)9-4-6-10(12)7-5-9;1-2-4-5-3-1;2*1-2/h3-8,11-12H,1H2,2H3;1-5H2;2*1-2H3.
What are the key properties of cyclopentane;ethane;4-[1-(ethenylamino)ethyl]phenol?
cyclopentane;ethane;4-[1-(ethenylamino)ethyl]phenol has a molecular weight of 293.50 g/mol, XLogP of 6.19, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentane;ethane;4-[1-(ethenylamino)ethyl]phenol is sourced from PubChem (CID 144603163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).