C20H26N4O2 — CID 144603486
1-[(2-ethoxyphenyl)methyl]-8-N-(2-methoxyethyl)-5H-pyrrolo[2,3-c]azepine-6,8-diamine (PubChem CID 144603486) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 1-[(2-ethoxyphenyl)methyl]-8-N-(2-methoxyethyl)-5H-pyrrolo[2,3-c]azepine-6,8-diamine.
| Compound Name | 1-[(2-ethoxyphenyl)methyl]-8-N-(2-methoxyethyl)-5H-pyrrolo[2,3-c]azepine-6,8-diamine |
|---|---|
| PubChem CID | 144603486 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 1-[(2-ethoxyphenyl)methyl]-8-N-(2-methoxyethyl)-5H-pyrrolo[2,3-c]azepine-6,8-diamine |
| SMILES | CCOc1ccccc1Cn1ccc2c1=C(NCCOC)N=C(N)CC=2 |
| InChI | InChI=1S/C20H26N4O2/c1-3-26-17-7-5-4-6-16(17)14-24-12-10-15-8-9-18(21)23-20(19(15)24)22-11-13-25-2/h4-8,10,12,22H,3,9,11,13-14H2,1-2H3,(H2,21,23) |
| InChIKey | YSUICXQFVSPLSE-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|