C21H23F5N2O — CID 144603619
(2E)-N-[[4,4-difluoro-1-[6-(trifluoromethyl)-3-pyridinyl]cyclohexyl]methyl]-2-prop-1-en-2-ylpenta-2,4-dienamide (PubChem CID 144603619) has the molecular formula C21H23F5N2O and a molecular weight of 414.42 g/mol. Its IUPAC name is (2E)-N-[[4,4-difluoro-1-[6-(trifluoromethyl)-3-pyridinyl]cyclohexyl]methyl]-2-prop-1-en-2-ylpenta-2,4-dienamide.
| Compound Name | (2E)-N-[[4,4-difluoro-1-[6-(trifluoromethyl)-3-pyridinyl]cyclohexyl]methyl]-2-prop-1-en-2-ylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 144603619 |
| Molecular Formula | C21H23F5N2O |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | (2E)-N-[[4,4-difluoro-1-[6-(trifluoromethyl)-3-pyridinyl]cyclohexyl]methyl]-2-prop-1-en-2-ylpenta-2,4-dienamide |
| SMILES | C=C/C=C(\C(=C)C)C(=O)NCC1(c2ccc(C(F)(F)F)nc2)CCC(F)(F)CC1 |
| InChI | InChI=1S/C21H23F5N2O/c1-4-5-16(14(2)3)18(29)28-13-19(8-10-20(22,23)11-9-19)15-6-7-17(27-12-15)21(24,25)26/h4-7,12H,1-2,8-11,13H2,3H3,(H,28,29)/b16-5+ |
| InChIKey | ALFHLTYOKSVQSP-FZSIALSZSA-N |
| XLogP | 5.35 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|