C19H24ClN3O2 — CID 144603698
(2Z)-2-(1-chloroethenyl)-4-methyl-N-(2-morpholin-4-yl-2-pyridin-4-ylethyl)penta-2,4-dienamide (PubChem CID 144603698) has the molecular formula C19H24ClN3O2 and a molecular weight of 361.87 g/mol. Its IUPAC name is (2Z)-2-(1-chloroethenyl)-4-methyl-N-(2-morpholin-4-yl-2-pyridin-4-ylethyl)penta-2,4-dienamide.
| Compound Name | (2Z)-2-(1-chloroethenyl)-4-methyl-N-(2-morpholin-4-yl-2-pyridin-4-ylethyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 144603698 |
| Molecular Formula | C19H24ClN3O2 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | (2Z)-2-(1-chloroethenyl)-4-methyl-N-(2-morpholin-4-yl-2-pyridin-4-ylethyl)penta-2,4-dienamide |
| SMILES | C=C(C)/C=C(\C(=C)Cl)C(=O)NCC(c1ccncc1)N1CCOCC1 |
| InChI | InChI=1S/C19H24ClN3O2/c1-14(2)12-17(15(3)20)19(24)22-13-18(16-4-6-21-7-5-16)23-8-10-25-11-9-23/h4-7,12,18H,1,3,8-11,13H2,2H3,(H,22,24)/b17-12+ |
| InChIKey | ROOLHTUSVBLHEO-SFQUDFHCSA-N |
| XLogP | 2.83 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|