C9H11ClN2 — CID 144603923
(Z)-1-(3-chloro-2-methylphenyl)ethene-1,2-diamine (PubChem CID 144603923) has the molecular formula C9H11ClN2 and a molecular weight of 182.65 g/mol. Its IUPAC name is (Z)-1-(3-chloro-2-methylphenyl)ethene-1,2-diamine.
| Compound Name | (Z)-1-(3-chloro-2-methylphenyl)ethene-1,2-diamine |
|---|---|
| PubChem CID | 144603923 |
| Molecular Formula | C9H11ClN2 |
| Molecular Weight | 182.65 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | (Z)-1-(3-chloro-2-methylphenyl)ethene-1,2-diamine |
| SMILES | Cc1c(Cl)cccc1/C(N)=C/N |
| InChI | InChI=1S/C9H11ClN2/c1-6-7(9(12)5-11)3-2-4-8(6)10/h2-5H,11-12H2,1H3/b9-5- |
| InChIKey | BFZHYOPDTCZUDE-UITAMQMPSA-N |
| XLogP | 1.86 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.65 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |