C12H12F3NO2 — CID 144604031
5-methyl-3-[(3Z,5Z)-4-(trifluoromethoxy)hepta-1,3,5-trien-3-yl]-1,2-oxazole (PubChem CID 144604031) has the molecular formula C12H12F3NO2 and a molecular weight of 259.23 g/mol. Its IUPAC name is 5-methyl-3-[(3Z,5Z)-4-(trifluoromethoxy)hepta-1,3,5-trien-3-yl]-1,2-oxazole.
| Compound Name | 5-methyl-3-[(3Z,5Z)-4-(trifluoromethoxy)hepta-1,3,5-trien-3-yl]-1,2-oxazole |
|---|---|
| PubChem CID | 144604031 |
| Molecular Formula | C12H12F3NO2 |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 5-methyl-3-[(3Z,5Z)-4-(trifluoromethoxy)hepta-1,3,5-trien-3-yl]-1,2-oxazole |
| SMILES | C=C/C(=C(\C=C/C)OC(F)(F)F)c1cc(C)on1 |
| InChI | InChI=1S/C12H12F3NO2/c1-4-6-11(17-12(13,14)15)9(5-2)10-7-8(3)18-16-10/h4-7H,2H2,1,3H3/b6-4-,11-9- |
| InChIKey | DTTIYMPETCDSBS-MJCCWDFWSA-N |
| XLogP | 3.99 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|