C26H35NO6 — CID 144604120
[(1R,3E,7S,11E,15R)-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-15-yl] 6-(2,5-dioxopyrrol-1-yl)hexanoate (PubChem CID 144604120) has the molecular formula C26H35NO6 and a molecular weight of 457.57 g/mol. Its IUPAC name is [(1R,3E,7S,11E,15R)-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-15-yl] 6-(2,5-dioxopyrrol-1-yl)hexanoate.
| Compound Name | [(1R,3E,7S,11E,15R)-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-15-yl] 6-(2,5-dioxopyrrol-1-yl)hexanoate |
|---|---|
| PubChem CID | 144604120 |
| Molecular Formula | C26H35NO6 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | [(1R,3E,7S,11E,15R)-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-15-yl] 6-(2,5-dioxopyrrol-1-yl)hexanoate |
| SMILES | C[C@H]1CCC/C=C/C2C[C@H](OC(=O)CCCCCN3C(=O)C=CC3=O)C[C@H]2C/C=C/C(=O)O1 |
| InChI | InChI=1S/C26H35NO6/c1-19-9-4-2-5-10-20-17-22(18-21(20)11-8-13-25(30)32-19)33-26(31)12-6-3-7-16-27-23(28)14-15-24(27)29/h5,8,10,13-15,19-22H,2-4,6-7,9,11-12,16-18H2,1H3/b10-5+,13-8+/t19-,20?,21+,22-/m0/s1 |
| InChIKey | JVKUWFQFKRSIBJ-KKNLOYOYSA-N |
| XLogP | 4.03 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|