About (2S)-N,N,2-trimethylaziridine-1-sulfonamide
(2S)-N,N,2-trimethylaziridine-1-sulfonamide (PubChem CID 144604186) has the molecular formula C5H12N2O2S
and a molecular weight of 164.23 g/mol. Its IUPAC name is (2S)-N,N,2-trimethylaziridine-1-sulfonamide.
Molecular Properties
| Compound Name | (2S)-N,N,2-trimethylaziridine-1-sulfonamide |
| PubChem CID | 144604186 |
| Molecular Formula | C5H12N2O2S |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | (2S)-N,N,2-trimethylaziridine-1-sulfonamide |
| SMILES | C[C@H]1CN1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C5H12N2O2S/c1-5-4-7(5)10(8,9)6(2)3/h5H,4H2,1-3H3/t5-,7?/m0/s1 |
| InChIKey | NHPOQSLCVISMDH-DSEUIKHZSA-N |
| XLogP | -0.50 |
| TPSA | 40.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2S)-N,N,2-trimethylaziridine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N,N,2-trimethylaziridine-1-sulfonamide?
The IUPAC name of (2S)-N,N,2-trimethylaziridine-1-sulfonamide (CID 144604186) is (2S)-N,N,2-trimethylaziridine-1-sulfonamide.
What is the SMILES notation for (2S)-N,N,2-trimethylaziridine-1-sulfonamide?
The canonical SMILES for (2S)-N,N,2-trimethylaziridine-1-sulfonamide is C[C@H]1CN1S(=O)(=O)N(C)C.
What is the InChIKey of (2S)-N,N,2-trimethylaziridine-1-sulfonamide?
The InChIKey is NHPOQSLCVISMDH-DSEUIKHZSA-N. The full InChI is InChI=1S/C5H12N2O2S/c1-5-4-7(5)10(8,9)6(2)3/h5H,4H2,1-3H3/t5-,7?/m0/s1.
What are the key properties of (2S)-N,N,2-trimethylaziridine-1-sulfonamide?
(2S)-N,N,2-trimethylaziridine-1-sulfonamide has a molecular weight of 164.23 g/mol, XLogP of -0.50, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N,N,2-trimethylaziridine-1-sulfonamide is sourced from PubChem (CID 144604186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).