C7HCl2F2N3 — CID 144604969
(2,5-dichloro-3,6-difluoro-4-iminocyclohexa-2,5-dien-1-ylidene)cyanamide (PubChem CID 144604969) has the molecular formula C7HCl2F2N3 and a molecular weight of 236.01 g/mol. Its IUPAC name is (2,5-dichloro-3,6-difluoro-4-iminocyclohexa-2,5-dien-1-ylidene)cyanamide.
| Compound Name | (2,5-dichloro-3,6-difluoro-4-iminocyclohexa-2,5-dien-1-ylidene)cyanamide |
|---|---|
| PubChem CID | 144604969 |
| Molecular Formula | C7HCl2F2N3 |
| Molecular Weight | 236.01 g/mol |
| Exact Mass | 234.95 |
| IUPAC Name | (2,5-dichloro-3,6-difluoro-4-iminocyclohexa-2,5-dien-1-ylidene)cyanamide |
| SMILES | [H]/N=C1\C(F)=C(Cl)/C(=N/C#N)C(F)=C1Cl |
| InChI | InChI=1S/C7HCl2F2N3/c8-2-5(11)7(14-1-12)3(9)4(10)6(2)13/h13H/b13-6-,14-7- |
| InChIKey | BCWNLXNIPDMYPB-POIBIGJCSA-N |
| XLogP | 2.78 |
| TPSA | 60.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.01 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|