C23H40F2N2O — CID 144605354
6,6-difluoro-N-methylhexan-3-amine;N-[2-[(2E,4Z,6E)-octa-2,4,6-trien-3-yl]cyclopropyl]oxan-4-amine (PubChem CID 144605354) has the molecular formula C23H40F2N2O and a molecular weight of 398.58 g/mol. Its IUPAC name is 6,6-difluoro-N-methylhexan-3-amine;N-[2-[(2E,4Z,6E)-octa-2,4,6-trien-3-yl]cyclopropyl]oxan-4-amine.
| Compound Name | 6,6-difluoro-N-methylhexan-3-amine;N-[2-[(2E,4Z,6E)-octa-2,4,6-trien-3-yl]cyclopropyl]oxan-4-amine |
|---|---|
| PubChem CID | 144605354 |
| Molecular Formula | C23H40F2N2O |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.31 |
| IUPAC Name | 6,6-difluoro-N-methylhexan-3-amine;N-[2-[(2E,4Z,6E)-octa-2,4,6-trien-3-yl]cyclopropyl]oxan-4-amine |
| SMILES | C/C=C/C=C\C(=C/C)C1CC1NC1CCOCC1.CCC(CCC(F)F)NC |
| InChI | InChI=1S/C16H25NO.C7H15F2N/c1-3-5-6-7-13(4-2)15-12-16(15)17-14-8-10-18-11-9-14;1-3-6(10-2)4-5-7(8)9/h3-7,14-17H,8-12H2,1-2H3;6-7,10H,3-5H2,1-2H3/b5-3+,7-6-,13-4+; |
| InChIKey | WVGRYNKYOJVTAN-NZAKSUGESA-N |
| XLogP | 5.25 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|