C18H19NO8 — CID 144605475
(1S,2S,3R,5S)-3-ethoxycarbonyl-5-(4-ethynylphenyl)-1,3-dihydroxy-2-nitrocyclohexane-1-carboxylic acid (PubChem CID 144605475) has the molecular formula C18H19NO8 and a molecular weight of 377.35 g/mol. Its IUPAC name is (1S,2S,3R,5S)-3-ethoxycarbonyl-5-(4-ethynylphenyl)-1,3-dihydroxy-2-nitrocyclohexane-1-carboxylic acid.
| Compound Name | (1S,2S,3R,5S)-3-ethoxycarbonyl-5-(4-ethynylphenyl)-1,3-dihydroxy-2-nitrocyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 144605475 |
| Molecular Formula | C18H19NO8 |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | (1S,2S,3R,5S)-3-ethoxycarbonyl-5-(4-ethynylphenyl)-1,3-dihydroxy-2-nitrocyclohexane-1-carboxylic acid |
| SMILES | C#Cc1ccc([C@H]2C[C@@](O)(C(=O)O)[C@H]([N+](=O)[O-])[C@@](O)(C(=O)OCC)C2)cc1 |
| InChI | InChI=1S/C18H19NO8/c1-3-11-5-7-12(8-6-11)13-9-17(23,15(20)21)14(19(25)26)18(24,10-13)16(22)27-4-2/h1,5-8,13-14,23-24H,4,9-10H2,2H3,(H,20,21)/t13-,14-,17-,18+/m0/s1 |
| InChIKey | ROHDCRVJIPMSAE-DFEHZGFQSA-N |
| XLogP | 0.30 |
| TPSA | 147.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|