C33H53N5O4 — CID 144606778
11-[2-acetyl-1-[1-[1-(2,3-diaminobutanoyl)pyrrolidin-2-yl]ethenyl]pyrrolidin-2-yl]-3-amino-2-hydroxy-6-phenylundecan-4-one (PubChem CID 144606778) has the molecular formula C33H53N5O4 and a molecular weight of 583.82 g/mol. Its IUPAC name is 11-[2-acetyl-1-[1-[1-(2,3-diaminobutanoyl)pyrrolidin-2-yl]ethenyl]pyrrolidin-2-yl]-3-amino-2-hydroxy-6-phenylundecan-4-one.
| Compound Name | 11-[2-acetyl-1-[1-[1-(2,3-diaminobutanoyl)pyrrolidin-2-yl]ethenyl]pyrrolidin-2-yl]-3-amino-2-hydroxy-6-phenylundecan-4-one |
|---|---|
| PubChem CID | 144606778 |
| Molecular Formula | C33H53N5O4 |
| Molecular Weight | 583.82 g/mol |
| Exact Mass | 583.41 |
| IUPAC Name | 11-[2-acetyl-1-[1-[1-(2,3-diaminobutanoyl)pyrrolidin-2-yl]ethenyl]pyrrolidin-2-yl]-3-amino-2-hydroxy-6-phenylundecan-4-one |
| SMILES | C=C(C1CCCN1C(=O)C(N)C(C)N)N1CCCC1(CCCCCC(CC(=O)C(N)C(C)O)c1ccccc1)C(C)=O |
| InChI | InChI=1S/C33H53N5O4/c1-22(34)30(35)32(42)37-19-11-16-28(37)23(2)38-20-12-18-33(38,25(4)40)17-10-6-9-15-27(26-13-7-5-8-14-26)21-29(41)31(36)24(3)39/h5,7-8,13-14,22,24,27-28,30-31,39H,2,6,9-12,15-21,34-36H2,1,3-4H3 |
| InChIKey | XCIVBUNOYHNFRY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 155.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.82 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|