C33H21F3N8O3S2 — CID 144606788
2,4,6-trifluoro-N-[5-[1-[[2-[1-methyl-5-(5-nitrothiophen-2-yl)pyrazol-3-yl]-4-pyridinyl]methyl]-3-pyridin-2-ylpyrazol-5-yl]thiophen-2-yl]benzamide (PubChem CID 144606788) has the molecular formula C33H21F3N8O3S2 and a molecular weight of 698.71 g/mol. Its IUPAC name is 2,4,6-trifluoro-N-[5-[1-[[2-[1-methyl-5-(5-nitrothiophen-2-yl)pyrazol-3-yl]-4-pyridinyl]methyl]-3-pyridin-2-ylpyrazol-5-yl]thiophen-2-yl]benzamide.
| Compound Name | 2,4,6-trifluoro-N-[5-[1-[[2-[1-methyl-5-(5-nitrothiophen-2-yl)pyrazol-3-yl]-4-pyridinyl]methyl]-3-pyridin-2-ylpyrazol-5-yl]thiophen-2-yl]benzamide |
|---|---|
| PubChem CID | 144606788 |
| Molecular Formula | C33H21F3N8O3S2 |
| Molecular Weight | 698.71 g/mol |
| Exact Mass | 698.11 |
| IUPAC Name | 2,4,6-trifluoro-N-[5-[1-[[2-[1-methyl-5-(5-nitrothiophen-2-yl)pyrazol-3-yl]-4-pyridinyl]methyl]-3-pyridin-2-ylpyrazol-5-yl]thiophen-2-yl]benzamide |
| SMILES | Cn1nc(-c2cc(Cn3nc(-c4ccccn4)cc3-c3ccc(NC(=O)c4c(F)cc(F)cc4F)s3)ccn2)cc1-c1ccc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C33H21F3N8O3S2/c1-42-26(28-6-8-31(49-28)44(46)47)15-25(40-42)23-12-18(9-11-38-23)17-43-27(16-24(41-43)22-4-2-3-10-37-22)29-5-7-30(48-29)39-33(45)32-20(35)13-19(34)14-21(32)36/h2-16H,17H2,1H3,(H,39,45) |
| InChIKey | KYNOETBLKGNATL-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 133.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.71 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|