About ethane;2-methyl-4H-1,3-oxazol-5-one
ethane;2-methyl-4H-1,3-oxazol-5-one (PubChem CID 144606818) has the molecular formula C6H11NO2
and a molecular weight of 129.16 g/mol. Its IUPAC name is ethane;2-methyl-4H-1,3-oxazol-5-one.
Molecular Properties
| Compound Name | ethane;2-methyl-4H-1,3-oxazol-5-one |
| PubChem CID | 144606818 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | ethane;2-methyl-4H-1,3-oxazol-5-one |
| SMILES | CC.CC1=NCC(=O)O1 |
| InChI | InChI=1S/C4H5NO2.C2H6/c1-3-5-2-4(6)7-3;1-2/h2H2,1H3;1-2H3 |
| InChIKey | HJNHVBNWPRUJOG-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;2-methyl-4H-1,3-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methyl-4H-1,3-oxazol-5-one?
The IUPAC name of ethane;2-methyl-4H-1,3-oxazol-5-one (CID 144606818) is ethane;2-methyl-4H-1,3-oxazol-5-one.
What is the SMILES notation for ethane;2-methyl-4H-1,3-oxazol-5-one?
The canonical SMILES for ethane;2-methyl-4H-1,3-oxazol-5-one is CC.CC1=NCC(=O)O1.
What is the InChIKey of ethane;2-methyl-4H-1,3-oxazol-5-one?
The InChIKey is HJNHVBNWPRUJOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO2.C2H6/c1-3-5-2-4(6)7-3;1-2/h2H2,1H3;1-2H3.
What are the key properties of ethane;2-methyl-4H-1,3-oxazol-5-one?
ethane;2-methyl-4H-1,3-oxazol-5-one has a molecular weight of 129.16 g/mol, XLogP of 0.99, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyl-4H-1,3-oxazol-5-one is sourced from PubChem (CID 144606818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).