C18H26N2O — CID 144607257
ethane;1-[(3Z)-5-methylidenehepta-1,3-dien-2-yl]-3-(3-methylphenyl)urea (PubChem CID 144607257) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is ethane;1-[(3Z)-5-methylidenehepta-1,3-dien-2-yl]-3-(3-methylphenyl)urea.
| Compound Name | ethane;1-[(3Z)-5-methylidenehepta-1,3-dien-2-yl]-3-(3-methylphenyl)urea |
|---|---|
| PubChem CID | 144607257 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | ethane;1-[(3Z)-5-methylidenehepta-1,3-dien-2-yl]-3-(3-methylphenyl)urea |
| SMILES | C=C(/C=C\C(=C)NC(=O)Nc1cccc(C)c1)CC.CC |
| InChI | InChI=1S/C16H20N2O.C2H6/c1-5-12(2)9-10-14(4)17-16(19)18-15-8-6-7-13(3)11-15;1-2/h6-11H,2,4-5H2,1,3H3,(H2,17,18,19);1-2H3/b10-9-; |
| InChIKey | WUKBUDPFRLWXIT-KVVVOXFISA-N |
| XLogP | 5.18 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|