About ethane;1-methyl-4-[1-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]piperidin-4-yl]piperazine
ethane;1-methyl-4-[1-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]piperidin-4-yl]piperazine (PubChem CID 144607330) has the molecular formula C19H35N3
and a molecular weight of 305.51 g/mol. Its IUPAC name is ethane;1-methyl-4-[1-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]piperidin-4-yl]piperazine.
Molecular Properties
| Compound Name | ethane;1-methyl-4-[1-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]piperidin-4-yl]piperazine |
| PubChem CID | 144607330 |
| Molecular Formula | C19H35N3 |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.28 |
| IUPAC Name | ethane;1-methyl-4-[1-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]piperidin-4-yl]piperazine |
| SMILES | C=C(C)/C=C\C(=C)N1CCC(N2CCN(C)CC2)CC1.CC |
| InChI | InChI=1S/C17H29N3.C2H6/c1-15(2)5-6-16(3)19-9-7-17(8-10-19)20-13-11-18(4)12-14-20;1-2/h5-6,17H,1,3,7-14H2,2,4H3;1-2H3/b6-5-; |
| InChIKey | FTCZVVXXRVJLBN-YSMBQZINSA-N |
| XLogP | 3.37 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-methyl-4-[1-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]piperidin-4-yl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methyl-4-[1-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]piperidin-4-yl]piperazine?
The IUPAC name of ethane;1-methyl-4-[1-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]piperidin-4-yl]piperazine (CID 144607330) is ethane;1-methyl-4-[1-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]piperidin-4-yl]piperazine.
What is the SMILES notation for ethane;1-methyl-4-[1-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]piperidin-4-yl]piperazine?
The canonical SMILES for ethane;1-methyl-4-[1-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]piperidin-4-yl]piperazine is C=C(C)/C=C\C(=C)N1CCC(N2CCN(C)CC2)CC1.CC.
What is the InChIKey of ethane;1-methyl-4-[1-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]piperidin-4-yl]piperazine?
The InChIKey is FTCZVVXXRVJLBN-YSMBQZINSA-N. The full InChI is InChI=1S/C17H29N3.C2H6/c1-15(2)5-6-16(3)19-9-7-17(8-10-19)20-13-11-18(4)12-14-20;1-2/h5-6,17H,1,3,7-14H2,2,4H3;1-2H3/b6-5-;.
What are the key properties of ethane;1-methyl-4-[1-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]piperidin-4-yl]piperazine?
ethane;1-methyl-4-[1-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]piperidin-4-yl]piperazine has a molecular weight of 305.51 g/mol, XLogP of 3.37, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methyl-4-[1-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]piperidin-4-yl]piperazine is sourced from PubChem (CID 144607330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).