C14H27NO2 — CID 144607397
ethane;(3E)-3-methoxy-N-(2-methoxyethyl)-N,5-dimethylhexa-1,3,5-trien-2-amine (PubChem CID 144607397) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is ethane;(3E)-3-methoxy-N-(2-methoxyethyl)-N,5-dimethylhexa-1,3,5-trien-2-amine.
| Compound Name | ethane;(3E)-3-methoxy-N-(2-methoxyethyl)-N,5-dimethylhexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 144607397 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | ethane;(3E)-3-methoxy-N-(2-methoxyethyl)-N,5-dimethylhexa-1,3,5-trien-2-amine |
| SMILES | C=C(C)/C=C(/OC)C(=C)N(C)CCOC.CC |
| InChI | InChI=1S/C12H21NO2.C2H6/c1-10(2)9-12(15-6)11(3)13(4)7-8-14-5;1-2/h9H,1,3,7-8H2,2,4-6H3;1-2H3/b12-9+; |
| InChIKey | IJEWRDDDENWOMU-NBYYMMLRSA-N |
| XLogP | 3.21 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|