About ethane;2-methoxy-N-methyl-N-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]acetamide
ethane;2-methoxy-N-methyl-N-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]acetamide (PubChem CID 144607422) has the molecular formula C13H23NO2
and a molecular weight of 225.33 g/mol. Its IUPAC name is ethane;2-methoxy-N-methyl-N-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]acetamide.
Molecular Properties
| Compound Name | ethane;2-methoxy-N-methyl-N-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]acetamide |
| PubChem CID | 144607422 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | ethane;2-methoxy-N-methyl-N-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]acetamide |
| SMILES | C=C(C)/C=C\C(=C)N(C)C(=O)COC.CC |
| InChI | InChI=1S/C11H17NO2.C2H6/c1-9(2)6-7-10(3)12(4)11(13)8-14-5;1-2/h6-7H,1,3,8H2,2,4-5H3;1-2H3/b7-6-; |
| InChIKey | MCLRXIMXQZCTHV-NAFXZHHSSA-N |
| XLogP | 2.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methoxy-N-methyl-N-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methoxy-N-methyl-N-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]acetamide?
The IUPAC name of ethane;2-methoxy-N-methyl-N-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]acetamide (CID 144607422) is ethane;2-methoxy-N-methyl-N-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]acetamide.
What is the SMILES notation for ethane;2-methoxy-N-methyl-N-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]acetamide?
The canonical SMILES for ethane;2-methoxy-N-methyl-N-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]acetamide is C=C(C)/C=C\C(=C)N(C)C(=O)COC.CC.
What is the InChIKey of ethane;2-methoxy-N-methyl-N-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]acetamide?
The InChIKey is MCLRXIMXQZCTHV-NAFXZHHSSA-N. The full InChI is InChI=1S/C11H17NO2.C2H6/c1-9(2)6-7-10(3)12(4)11(13)8-14-5;1-2/h6-7H,1,3,8H2,2,4-5H3;1-2H3/b7-6-;.
What are the key properties of ethane;2-methoxy-N-methyl-N-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]acetamide?
ethane;2-methoxy-N-methyl-N-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]acetamide has a molecular weight of 225.33 g/mol, XLogP of 2.76, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methoxy-N-methyl-N-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]acetamide is sourced from PubChem (CID 144607422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).