About 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-4-methyl-1H-pyrrole;molecular hydrogen
3-(2,2-difluoro-1,3-benzodioxol-4-yl)-4-methyl-1H-pyrrole;molecular hydrogen (PubChem CID 144607700) has the molecular formula C12H11F2NO2
and a molecular weight of 239.22 g/mol. Its IUPAC name is 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-4-methyl-1H-pyrrole;molecular hydrogen.
Molecular Properties
| Compound Name | 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-4-methyl-1H-pyrrole;molecular hydrogen |
| PubChem CID | 144607700 |
| Molecular Formula | C12H11F2NO2 |
| Molecular Weight | 239.22 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-4-methyl-1H-pyrrole;molecular hydrogen |
| SMILES | Cc1c[nH]cc1-c1cccc2c1OC(F)(F)O2.[H][H] |
| InChI | InChI=1S/C12H9F2NO2.H2/c1-7-5-15-6-9(7)8-3-2-4-10-11(8)17-12(13,14)16-10;/h2-6,15H,1H3;1H |
| InChIKey | GPMIUIAVISDRJH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.22 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-4-methyl-1H-pyrrole;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-4-methyl-1H-pyrrole;molecular hydrogen?
The IUPAC name of 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-4-methyl-1H-pyrrole;molecular hydrogen (CID 144607700) is 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-4-methyl-1H-pyrrole;molecular hydrogen.
What is the SMILES notation for 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-4-methyl-1H-pyrrole;molecular hydrogen?
The canonical SMILES for 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-4-methyl-1H-pyrrole;molecular hydrogen is Cc1c[nH]cc1-c1cccc2c1OC(F)(F)O2.[H][H].
What is the InChIKey of 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-4-methyl-1H-pyrrole;molecular hydrogen?
The InChIKey is GPMIUIAVISDRJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9F2NO2.H2/c1-7-5-15-6-9(7)8-3-2-4-10-11(8)17-12(13,14)16-10;/h2-6,15H,1H3;1H.
What are the key properties of 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-4-methyl-1H-pyrrole;molecular hydrogen?
3-(2,2-difluoro-1,3-benzodioxol-4-yl)-4-methyl-1H-pyrrole;molecular hydrogen has a molecular weight of 239.22 g/mol, XLogP of 3.56, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-4-methyl-1H-pyrrole;molecular hydrogen is sourced from PubChem (CID 144607700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).