C20H29F2N3OS — CID 144608153
(2R)-2-(2,5-difluorophenyl)-N-methyl-5-(6-propan-2-ylsulfanyl-3,6-diazabicyclo[3.2.0]heptan-3-yl)oxan-3-amine (PubChem CID 144608153) has the molecular formula C20H29F2N3OS and a molecular weight of 397.54 g/mol. Its IUPAC name is (2R)-2-(2,5-difluorophenyl)-N-methyl-5-(6-propan-2-ylsulfanyl-3,6-diazabicyclo[3.2.0]heptan-3-yl)oxan-3-amine.
| Compound Name | (2R)-2-(2,5-difluorophenyl)-N-methyl-5-(6-propan-2-ylsulfanyl-3,6-diazabicyclo[3.2.0]heptan-3-yl)oxan-3-amine |
|---|---|
| PubChem CID | 144608153 |
| Molecular Formula | C20H29F2N3OS |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | (2R)-2-(2,5-difluorophenyl)-N-methyl-5-(6-propan-2-ylsulfanyl-3,6-diazabicyclo[3.2.0]heptan-3-yl)oxan-3-amine |
| SMILES | CNC1CC(N2CC3CN(SC(C)C)C3C2)CO[C@@H]1c1cc(F)ccc1F |
| InChI | InChI=1S/C20H29F2N3OS/c1-12(2)27-25-9-13-8-24(10-19(13)25)15-7-18(23-3)20(26-11-15)16-6-14(21)4-5-17(16)22/h4-6,12-13,15,18-20,23H,7-11H2,1-3H3/t13?,15?,18?,19?,20-/m1/s1 |
| InChIKey | ILLUNSGZUPNXFI-AZWTZASPSA-N |
| XLogP | 3.06 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|