C12H23N3O — CID 144608183
5-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl)-N-methyloxan-3-amine (PubChem CID 144608183) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is 5-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl)-N-methyloxan-3-amine.
| Compound Name | 5-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl)-N-methyloxan-3-amine |
|---|---|
| PubChem CID | 144608183 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | 5-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl)-N-methyloxan-3-amine |
| SMILES | CNC1COCC(N2CC3CCNC3C2)C1 |
| InChI | InChI=1S/C12H23N3O/c1-13-10-4-11(8-16-7-10)15-5-9-2-3-14-12(9)6-15/h9-14H,2-8H2,1H3 |
| InChIKey | VHTZVJYJRCSMEW-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |