C21H31F2N3OS — CID 144608189
5-(2-cyclopropylsulfanyl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl)oxan-3-amine;1,4-difluorobenzene (PubChem CID 144608189) has the molecular formula C21H31F2N3OS and a molecular weight of 411.56 g/mol. Its IUPAC name is 5-(2-cyclopropylsulfanyl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl)oxan-3-amine;1,4-difluorobenzene.
| Compound Name | 5-(2-cyclopropylsulfanyl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl)oxan-3-amine;1,4-difluorobenzene |
|---|---|
| PubChem CID | 144608189 |
| Molecular Formula | C21H31F2N3OS |
| Molecular Weight | 411.56 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 5-(2-cyclopropylsulfanyl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl)oxan-3-amine;1,4-difluorobenzene |
| SMILES | Fc1ccc(F)cc1.NC1COCC(N2CCC3CN(SC4CC4)CC3C2)C1 |
| InChI | InChI=1S/C15H27N3OS.C6H4F2/c16-13-5-14(10-19-9-13)17-4-3-11-7-18(8-12(11)6-17)20-15-1-2-15;7-5-1-2-6(8)4-3-5/h11-15H,1-10,16H2;1-4H |
| InChIKey | RJGVZTAWZZZVMV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.56 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|