C23H20O5 — CID 144608396
2,6,7-trihydroxy-9-[(3Z,5E,7Z)-7-methylnona-1,3,5,7-tetraen-5-yl]xanthen-3-one (PubChem CID 144608396) has the molecular formula C23H20O5 and a molecular weight of 376.41 g/mol. Its IUPAC name is 2,6,7-trihydroxy-9-[(3Z,5E,7Z)-7-methylnona-1,3,5,7-tetraen-5-yl]xanthen-3-one.
| Compound Name | 2,6,7-trihydroxy-9-[(3Z,5E,7Z)-7-methylnona-1,3,5,7-tetraen-5-yl]xanthen-3-one |
|---|---|
| PubChem CID | 144608396 |
| Molecular Formula | C23H20O5 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 2,6,7-trihydroxy-9-[(3Z,5E,7Z)-7-methylnona-1,3,5,7-tetraen-5-yl]xanthen-3-one |
| SMILES | C=C/C=C\C(=C/C(C)=C\C)c1c2cc(O)c(=O)cc-2oc2cc(O)c(O)cc12 |
| InChI | InChI=1S/C23H20O5/c1-4-6-7-14(8-13(3)5-2)23-15-9-17(24)19(26)11-21(15)28-22-12-20(27)18(25)10-16(22)23/h4-12,24-26H,1H2,2-3H3/b7-6-,13-5-,14-8+ |
| InChIKey | RCIZQTABKJAGGT-VFHYNHRCSA-N |
| XLogP | 5.11 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|