C12H15N3O2S — CID 14461005
1-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-3,4-dimethylpyrrole-2,5-dione (PubChem CID 14461005) has the molecular formula C12H15N3O2S and a molecular weight of 265.34 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-3,4-dimethylpyrrole-2,5-dione.
| Compound Name | 1-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-3,4-dimethylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 14461005 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 1-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-3,4-dimethylpyrrole-2,5-dione |
| SMILES | CC1=C(C)C(=O)N(c2nnc(C(C)(C)C)s2)C1=O |
| InChI | InChI=1S/C12H15N3O2S/c1-6-7(2)9(17)15(8(6)16)11-14-13-10(18-11)12(3,4)5/h1-5H3 |
| InChIKey | NVBOYORWHNNKIT-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|