C28H44N4O3 — CID 144610605
3-[ethyl(oxan-4-yl)amino]-2-methyl-5-[(10Z,12E)-4-methyl-1,4,8-triazacyclotrideca-8,10,12-trien-10-yl]benzaldehyde;methoxymethane (PubChem CID 144610605) has the molecular formula C28H44N4O3 and a molecular weight of 484.69 g/mol. Its IUPAC name is 3-[ethyl(oxan-4-yl)amino]-2-methyl-5-[(10Z,12E)-4-methyl-1,4,8-triazacyclotrideca-8,10,12-trien-10-yl]benzaldehyde;methoxymethane.
| Compound Name | 3-[ethyl(oxan-4-yl)amino]-2-methyl-5-[(10Z,12E)-4-methyl-1,4,8-triazacyclotrideca-8,10,12-trien-10-yl]benzaldehyde;methoxymethane |
|---|---|
| PubChem CID | 144610605 |
| Molecular Formula | C28H44N4O3 |
| Molecular Weight | 484.69 g/mol |
| Exact Mass | 484.34 |
| IUPAC Name | 3-[ethyl(oxan-4-yl)amino]-2-methyl-5-[(10Z,12E)-4-methyl-1,4,8-triazacyclotrideca-8,10,12-trien-10-yl]benzaldehyde;methoxymethane |
| SMILES | CCN(c1cc(C2=C/C=C/NCCN(C)CCC\N=C\2)cc(C=O)c1C)C1CCOCC1.COC |
| InChI | InChI=1S/C26H38N4O2.C2H6O/c1-4-30(25-8-15-32-16-9-25)26-18-23(17-24(20-31)21(26)2)22-7-5-10-27-12-14-29(3)13-6-11-28-19-22;1-3-2/h5,7,10,17-20,25,27H,4,6,8-9,11-16H2,1-3H3;1-2H3/b10-5+,22-7+,28-19+; |
| InChIKey | OAIVQZNOYZPWFL-CFUMQGRVSA-N |
| XLogP | 3.97 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.69 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|