About N-ethyl-N-(4-methylpenta-1,3-dien-3-yl)oxan-4-amine
N-ethyl-N-(4-methylpenta-1,3-dien-3-yl)oxan-4-amine (PubChem CID 144610740) has the molecular formula C13H23NO
and a molecular weight of 209.33 g/mol. Its IUPAC name is N-ethyl-N-(4-methylpenta-1,3-dien-3-yl)oxan-4-amine.
Molecular Properties
| Compound Name | N-ethyl-N-(4-methylpenta-1,3-dien-3-yl)oxan-4-amine |
| PubChem CID | 144610740 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | N-ethyl-N-(4-methylpenta-1,3-dien-3-yl)oxan-4-amine |
| SMILES | C=CC(=C(C)C)N(CC)C1CCOCC1 |
| InChI | InChI=1S/C13H23NO/c1-5-13(11(3)4)14(6-2)12-7-9-15-10-8-12/h5,12H,1,6-10H2,2-4H3 |
| InChIKey | MNXKFWOIQCDFLJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-(4-methylpenta-1,3-dien-3-yl)oxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-(4-methylpenta-1,3-dien-3-yl)oxan-4-amine?
The IUPAC name of N-ethyl-N-(4-methylpenta-1,3-dien-3-yl)oxan-4-amine (CID 144610740) is N-ethyl-N-(4-methylpenta-1,3-dien-3-yl)oxan-4-amine.
What is the SMILES notation for N-ethyl-N-(4-methylpenta-1,3-dien-3-yl)oxan-4-amine?
The canonical SMILES for N-ethyl-N-(4-methylpenta-1,3-dien-3-yl)oxan-4-amine is C=CC(=C(C)C)N(CC)C1CCOCC1.
What is the InChIKey of N-ethyl-N-(4-methylpenta-1,3-dien-3-yl)oxan-4-amine?
The InChIKey is MNXKFWOIQCDFLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO/c1-5-13(11(3)4)14(6-2)12-7-9-15-10-8-12/h5,12H,1,6-10H2,2-4H3.
What are the key properties of N-ethyl-N-(4-methylpenta-1,3-dien-3-yl)oxan-4-amine?
N-ethyl-N-(4-methylpenta-1,3-dien-3-yl)oxan-4-amine has a molecular weight of 209.33 g/mol, XLogP of 2.97, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-(4-methylpenta-1,3-dien-3-yl)oxan-4-amine is sourced from PubChem (CID 144610740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).