About 5-(2-methyloctan-2-yl)-2-(3-morpholin-4-ylcyclohexyl)benzene-1,3-diol;prop-1-ene
5-(2-methyloctan-2-yl)-2-(3-morpholin-4-ylcyclohexyl)benzene-1,3-diol;prop-1-ene (PubChem CID 144611258) has the molecular formula C28H47NO3
and a molecular weight of 445.69 g/mol. Its IUPAC name is 5-(2-methyloctan-2-yl)-2-(3-morpholin-4-ylcyclohexyl)benzene-1,3-diol;prop-1-ene.
Molecular Properties
| Compound Name | 5-(2-methyloctan-2-yl)-2-(3-morpholin-4-ylcyclohexyl)benzene-1,3-diol;prop-1-ene |
| PubChem CID | 144611258 |
| Molecular Formula | C28H47NO3 |
| Molecular Weight | 445.69 g/mol |
| Exact Mass | 445.36 |
| IUPAC Name | 5-(2-methyloctan-2-yl)-2-(3-morpholin-4-ylcyclohexyl)benzene-1,3-diol;prop-1-ene |
| SMILES | C=CC.CCCCCCC(C)(C)c1cc(O)c(C2CCCC(N3CCOCC3)C2)c(O)c1 |
| InChI | InChI=1S/C25H41NO3.C3H6/c1-4-5-6-7-11-25(2,3)20-17-22(27)24(23(28)18-20)19-9-8-10-21(16-19)26-12-14-29-15-13-26;1-3-2/h17-19,21,27-28H,4-16H2,1-3H3;3H,1H2,2H3 |
| InChIKey | FNUJFPORJHUJLL-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.69 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-methyloctan-2-yl)-2-(3-morpholin-4-ylcyclohexyl)benzene-1,3-diol;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-methyloctan-2-yl)-2-(3-morpholin-4-ylcyclohexyl)benzene-1,3-diol;prop-1-ene?
The IUPAC name of 5-(2-methyloctan-2-yl)-2-(3-morpholin-4-ylcyclohexyl)benzene-1,3-diol;prop-1-ene (CID 144611258) is 5-(2-methyloctan-2-yl)-2-(3-morpholin-4-ylcyclohexyl)benzene-1,3-diol;prop-1-ene.
What is the SMILES notation for 5-(2-methyloctan-2-yl)-2-(3-morpholin-4-ylcyclohexyl)benzene-1,3-diol;prop-1-ene?
The canonical SMILES for 5-(2-methyloctan-2-yl)-2-(3-morpholin-4-ylcyclohexyl)benzene-1,3-diol;prop-1-ene is C=CC.CCCCCCC(C)(C)c1cc(O)c(C2CCCC(N3CCOCC3)C2)c(O)c1.
What is the InChIKey of 5-(2-methyloctan-2-yl)-2-(3-morpholin-4-ylcyclohexyl)benzene-1,3-diol;prop-1-ene?
The InChIKey is FNUJFPORJHUJLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H41NO3.C3H6/c1-4-5-6-7-11-25(2,3)20-17-22(27)24(23(28)18-20)19-9-8-10-21(16-19)26-12-14-29-15-13-26;1-3-2/h17-19,21,27-28H,4-16H2,1-3H3;3H,1H2,2H3.
What are the key properties of 5-(2-methyloctan-2-yl)-2-(3-morpholin-4-ylcyclohexyl)benzene-1,3-diol;prop-1-ene?
5-(2-methyloctan-2-yl)-2-(3-morpholin-4-ylcyclohexyl)benzene-1,3-diol;prop-1-ene has a molecular weight of 445.69 g/mol, XLogP of 6.90, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methyloctan-2-yl)-2-(3-morpholin-4-ylcyclohexyl)benzene-1,3-diol;prop-1-ene is sourced from PubChem (CID 144611258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).