C31H39N3O8 — CID 144611594
tert-butyl N-[5-[4-[3-deuterio-5-(3,4-diethoxyphenyl)-2H-1,2,4-oxadiazol-3-yl]-1-benzofuran-2-yl]-2,2-dimethyl-1,3-dioxan-5-yl]carbamate (PubChem CID 144611594) has the molecular formula C31H39N3O8 and a molecular weight of 582.67 g/mol. Its IUPAC name is tert-butyl N-[5-[4-[3-deuterio-5-(3,4-diethoxyphenyl)-2H-1,2,4-oxadiazol-3-yl]-1-benzofuran-2-yl]-2,2-dimethyl-1,3-dioxan-5-yl]carbamate.
| Compound Name | tert-butyl N-[5-[4-[3-deuterio-5-(3,4-diethoxyphenyl)-2H-1,2,4-oxadiazol-3-yl]-1-benzofuran-2-yl]-2,2-dimethyl-1,3-dioxan-5-yl]carbamate |
|---|---|
| PubChem CID | 144611594 |
| Molecular Formula | C31H39N3O8 |
| Molecular Weight | 582.67 g/mol |
| Exact Mass | 582.28 |
| IUPAC Name | tert-butyl N-[5-[4-[3-deuterio-5-(3,4-diethoxyphenyl)-2H-1,2,4-oxadiazol-3-yl]-1-benzofuran-2-yl]-2,2-dimethyl-1,3-dioxan-5-yl]carbamate |
| SMILES | [2H]C1(c2cccc3oc(C4(NC(=O)OC(C)(C)C)COC(C)(C)OC4)cc23)N=C(c2ccc(OCC)c(OCC)c2)ON1 |
| InChI | InChI=1S/C31H39N3O8/c1-8-36-23-14-13-19(15-24(23)37-9-2)27-32-26(34-42-27)20-11-10-12-22-21(20)16-25(40-22)31(17-38-30(6,7)39-18-31)33-28(35)41-29(3,4)5/h10-16,26,34H,8-9,17-18H2,1-7H3,(H,33,35)/i26D |
| InChIKey | CJVYEXJAYYODSR-HKAOEGRMSA-N |
| XLogP | 5.71 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.67 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |