C17H25N5OS — CID 144612092
formamide;2-[4-(1-methylpiperidin-4-yl)-1H-pyrazol-5-yl]-4,5,6,7-tetrahydro-1,3-benzothiazole (PubChem CID 144612092) has the molecular formula C17H25N5OS and a molecular weight of 347.49 g/mol. Its IUPAC name is formamide;2-[4-(1-methylpiperidin-4-yl)-1H-pyrazol-5-yl]-4,5,6,7-tetrahydro-1,3-benzothiazole.
| Compound Name | formamide;2-[4-(1-methylpiperidin-4-yl)-1H-pyrazol-5-yl]-4,5,6,7-tetrahydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 144612092 |
| Molecular Formula | C17H25N5OS |
| Molecular Weight | 347.49 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | formamide;2-[4-(1-methylpiperidin-4-yl)-1H-pyrazol-5-yl]-4,5,6,7-tetrahydro-1,3-benzothiazole |
| SMILES | CN1CCC(c2cn[nH]c2-c2nc3c(s2)CCCC3)CC1.NC=O |
| InChI | InChI=1S/C16H22N4S.CH3NO/c1-20-8-6-11(7-9-20)12-10-17-19-15(12)16-18-13-4-2-3-5-14(13)21-16;2-1-3/h10-11H,2-9H2,1H3,(H,17,19);1H,(H2,2,3) |
| InChIKey | VVBOXBPGUYZTJV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.49 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|