About 5-(5,6-dihydro-1H-benzimidazol-2-yl)-1H-pyrazol-4-amine;ethane
5-(5,6-dihydro-1H-benzimidazol-2-yl)-1H-pyrazol-4-amine;ethane (PubChem CID 144612133) has the molecular formula C12H17N5
and a molecular weight of 231.30 g/mol. Its IUPAC name is 5-(5,6-dihydro-1H-benzimidazol-2-yl)-1H-pyrazol-4-amine;ethane.
Molecular Properties
| Compound Name | 5-(5,6-dihydro-1H-benzimidazol-2-yl)-1H-pyrazol-4-amine;ethane |
| PubChem CID | 144612133 |
| Molecular Formula | C12H17N5 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 5-(5,6-dihydro-1H-benzimidazol-2-yl)-1H-pyrazol-4-amine;ethane |
| SMILES | CC.Nc1cn[nH]c1-c1nc2c([nH]1)=CCCC=2 |
| InChI | InChI=1S/C10H11N5.C2H6/c11-6-5-12-15-9(6)10-13-7-3-1-2-4-8(7)14-10;1-2/h3-5H,1-2,11H2,(H,12,15)(H,13,14);1-2H3 |
| InChIKey | YKFQWEJTPCEEJL-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(5,6-dihydro-1H-benzimidazol-2-yl)-1H-pyrazol-4-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5,6-dihydro-1H-benzimidazol-2-yl)-1H-pyrazol-4-amine;ethane?
The IUPAC name of 5-(5,6-dihydro-1H-benzimidazol-2-yl)-1H-pyrazol-4-amine;ethane (CID 144612133) is 5-(5,6-dihydro-1H-benzimidazol-2-yl)-1H-pyrazol-4-amine;ethane.
What is the SMILES notation for 5-(5,6-dihydro-1H-benzimidazol-2-yl)-1H-pyrazol-4-amine;ethane?
The canonical SMILES for 5-(5,6-dihydro-1H-benzimidazol-2-yl)-1H-pyrazol-4-amine;ethane is CC.Nc1cn[nH]c1-c1nc2c([nH]1)=CCCC=2.
What is the InChIKey of 5-(5,6-dihydro-1H-benzimidazol-2-yl)-1H-pyrazol-4-amine;ethane?
The InChIKey is YKFQWEJTPCEEJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N5.C2H6/c11-6-5-12-15-9(6)10-13-7-3-1-2-4-8(7)14-10;1-2/h3-5H,1-2,11H2,(H,12,15)(H,13,14);1-2H3.
What are the key properties of 5-(5,6-dihydro-1H-benzimidazol-2-yl)-1H-pyrazol-4-amine;ethane?
5-(5,6-dihydro-1H-benzimidazol-2-yl)-1H-pyrazol-4-amine;ethane has a molecular weight of 231.30 g/mol, XLogP of 0.76, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5,6-dihydro-1H-benzimidazol-2-yl)-1H-pyrazol-4-amine;ethane is sourced from PubChem (CID 144612133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).