About 1-[5-(2-methylbutan-2-ylamino)-1,3-thiazol-4-yl]ethanone;propane
1-[5-(2-methylbutan-2-ylamino)-1,3-thiazol-4-yl]ethanone;propane (PubChem CID 144612164) has the molecular formula C13H24N2OS
and a molecular weight of 256.41 g/mol. Its IUPAC name is 1-[5-(2-methylbutan-2-ylamino)-1,3-thiazol-4-yl]ethanone;propane.
Molecular Properties
| Compound Name | 1-[5-(2-methylbutan-2-ylamino)-1,3-thiazol-4-yl]ethanone;propane |
| PubChem CID | 144612164 |
| Molecular Formula | C13H24N2OS |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 1-[5-(2-methylbutan-2-ylamino)-1,3-thiazol-4-yl]ethanone;propane |
| SMILES | CCC.CCC(C)(C)Nc1scnc1C(C)=O |
| InChI | InChI=1S/C10H16N2OS.C3H8/c1-5-10(3,4)12-9-8(7(2)13)11-6-14-9;1-3-2/h6,12H,5H2,1-4H3;3H2,1-2H3 |
| InChIKey | HMISQQLOTMKSJB-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[5-(2-methylbutan-2-ylamino)-1,3-thiazol-4-yl]ethanone;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(2-methylbutan-2-ylamino)-1,3-thiazol-4-yl]ethanone;propane?
The IUPAC name of 1-[5-(2-methylbutan-2-ylamino)-1,3-thiazol-4-yl]ethanone;propane (CID 144612164) is 1-[5-(2-methylbutan-2-ylamino)-1,3-thiazol-4-yl]ethanone;propane.
What is the SMILES notation for 1-[5-(2-methylbutan-2-ylamino)-1,3-thiazol-4-yl]ethanone;propane?
The canonical SMILES for 1-[5-(2-methylbutan-2-ylamino)-1,3-thiazol-4-yl]ethanone;propane is CCC.CCC(C)(C)Nc1scnc1C(C)=O.
What is the InChIKey of 1-[5-(2-methylbutan-2-ylamino)-1,3-thiazol-4-yl]ethanone;propane?
The InChIKey is HMISQQLOTMKSJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2OS.C3H8/c1-5-10(3,4)12-9-8(7(2)13)11-6-14-9;1-3-2/h6,12H,5H2,1-4H3;3H2,1-2H3.
What are the key properties of 1-[5-(2-methylbutan-2-ylamino)-1,3-thiazol-4-yl]ethanone;propane?
1-[5-(2-methylbutan-2-ylamino)-1,3-thiazol-4-yl]ethanone;propane has a molecular weight of 256.41 g/mol, XLogP of 4.36, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(2-methylbutan-2-ylamino)-1,3-thiazol-4-yl]ethanone;propane is sourced from PubChem (CID 144612164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).