C15H25NO3 — CID 144612333
2-(3-aminopropoxy)-4-propan-2-yl-2,3,4,6,7,8-hexahydrochromen-5-one (PubChem CID 144612333) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is 2-(3-aminopropoxy)-4-propan-2-yl-2,3,4,6,7,8-hexahydrochromen-5-one.
| Compound Name | 2-(3-aminopropoxy)-4-propan-2-yl-2,3,4,6,7,8-hexahydrochromen-5-one |
|---|---|
| PubChem CID | 144612333 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 2-(3-aminopropoxy)-4-propan-2-yl-2,3,4,6,7,8-hexahydrochromen-5-one |
| SMILES | CC(C)C1CC(OCCCN)OC2=C1C(=O)CCC2 |
| InChI | InChI=1S/C15H25NO3/c1-10(2)11-9-14(18-8-4-7-16)19-13-6-3-5-12(17)15(11)13/h10-11,14H,3-9,16H2,1-2H3 |
| InChIKey | TXEADQGVQDMUGH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|