C17H19NO — CID 144612402
3-phenyl-6-propyl-2,4-dihydro-1,3-benzoxazine (PubChem CID 144612402) has the molecular formula C17H19NO and a molecular weight of 253.34 g/mol. Its IUPAC name is 3-phenyl-6-propyl-2,4-dihydro-1,3-benzoxazine.
| Compound Name | 3-phenyl-6-propyl-2,4-dihydro-1,3-benzoxazine |
|---|---|
| PubChem CID | 144612402 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 3-phenyl-6-propyl-2,4-dihydro-1,3-benzoxazine |
| SMILES | CCCc1ccc2c(c1)CN(c1ccccc1)CO2 |
| InChI | InChI=1S/C17H19NO/c1-2-6-14-9-10-17-15(11-14)12-18(13-19-17)16-7-4-3-5-8-16/h3-5,7-11H,2,6,12-13H2,1H3 |
| InChIKey | XUBHHDINCLCCPR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |