About 2,8-dimethyl-7-[(1Z)-3-methylbuta-1,3-dienyl]quinoline;ethane
2,8-dimethyl-7-[(1Z)-3-methylbuta-1,3-dienyl]quinoline;ethane (PubChem CID 144612420) has the molecular formula C20H29N
and a molecular weight of 283.46 g/mol. Its IUPAC name is 2,8-dimethyl-7-[(1Z)-3-methylbuta-1,3-dienyl]quinoline;ethane.
Molecular Properties
| Compound Name | 2,8-dimethyl-7-[(1Z)-3-methylbuta-1,3-dienyl]quinoline;ethane |
| PubChem CID | 144612420 |
| Molecular Formula | C20H29N |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | 2,8-dimethyl-7-[(1Z)-3-methylbuta-1,3-dienyl]quinoline;ethane |
| SMILES | C=C(C)/C=C\c1ccc2ccc(C)nc2c1C.CC.CC |
| InChI | InChI=1S/C16H17N.2C2H6/c1-11(2)5-7-14-9-10-15-8-6-12(3)17-16(15)13(14)4;2*1-2/h5-10H,1H2,2-4H3;2*1-2H3/b7-5-;; |
| InChIKey | OGHPHGSSLHLWPY-MWKZNRQPSA-N |
| XLogP | 6.49 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2,8-dimethyl-7-[(1Z)-3-methylbuta-1,3-dienyl]quinoline;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,8-dimethyl-7-[(1Z)-3-methylbuta-1,3-dienyl]quinoline;ethane?
The IUPAC name of 2,8-dimethyl-7-[(1Z)-3-methylbuta-1,3-dienyl]quinoline;ethane (CID 144612420) is 2,8-dimethyl-7-[(1Z)-3-methylbuta-1,3-dienyl]quinoline;ethane.
What is the SMILES notation for 2,8-dimethyl-7-[(1Z)-3-methylbuta-1,3-dienyl]quinoline;ethane?
The canonical SMILES for 2,8-dimethyl-7-[(1Z)-3-methylbuta-1,3-dienyl]quinoline;ethane is C=C(C)/C=C\c1ccc2ccc(C)nc2c1C.CC.CC.
What is the InChIKey of 2,8-dimethyl-7-[(1Z)-3-methylbuta-1,3-dienyl]quinoline;ethane?
The InChIKey is OGHPHGSSLHLWPY-MWKZNRQPSA-N. The full InChI is InChI=1S/C16H17N.2C2H6/c1-11(2)5-7-14-9-10-15-8-6-12(3)17-16(15)13(14)4;2*1-2/h5-10H,1H2,2-4H3;2*1-2H3/b7-5-;;.
What are the key properties of 2,8-dimethyl-7-[(1Z)-3-methylbuta-1,3-dienyl]quinoline;ethane?
2,8-dimethyl-7-[(1Z)-3-methylbuta-1,3-dienyl]quinoline;ethane has a molecular weight of 283.46 g/mol, XLogP of 6.49, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8-dimethyl-7-[(1Z)-3-methylbuta-1,3-dienyl]quinoline;ethane is sourced from PubChem (CID 144612420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).