About [5,6-bis(4-fluorophenyl)-3-propan-2-ylpyridazin-4-yl]methanol
[5,6-bis(4-fluorophenyl)-3-propan-2-ylpyridazin-4-yl]methanol (PubChem CID 14461247) has the molecular formula C20H18F2N2O
and a molecular weight of 340.37 g/mol. Its IUPAC name is [5,6-bis(4-fluorophenyl)-3-propan-2-ylpyridazin-4-yl]methanol.
Molecular Properties
| Compound Name | [5,6-bis(4-fluorophenyl)-3-propan-2-ylpyridazin-4-yl]methanol |
| PubChem CID | 14461247 |
| Molecular Formula | C20H18F2N2O |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | [5,6-bis(4-fluorophenyl)-3-propan-2-ylpyridazin-4-yl]methanol |
| SMILES | CC(C)c1nnc(-c2ccc(F)cc2)c(-c2ccc(F)cc2)c1CO |
| InChI | InChI=1S/C20H18F2N2O/c1-12(2)19-17(11-25)18(13-3-7-15(21)8-4-13)20(24-23-19)14-5-9-16(22)10-6-14/h3-10,12,25H,11H2,1-2H3 |
| InChIKey | QYNIPQMAGZEZJJ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [5,6-bis(4-fluorophenyl)-3-propan-2-ylpyridazin-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5,6-bis(4-fluorophenyl)-3-propan-2-ylpyridazin-4-yl]methanol?
The IUPAC name of [5,6-bis(4-fluorophenyl)-3-propan-2-ylpyridazin-4-yl]methanol (CID 14461247) is [5,6-bis(4-fluorophenyl)-3-propan-2-ylpyridazin-4-yl]methanol.
What is the SMILES notation for [5,6-bis(4-fluorophenyl)-3-propan-2-ylpyridazin-4-yl]methanol?
The canonical SMILES for [5,6-bis(4-fluorophenyl)-3-propan-2-ylpyridazin-4-yl]methanol is CC(C)c1nnc(-c2ccc(F)cc2)c(-c2ccc(F)cc2)c1CO.
What is the InChIKey of [5,6-bis(4-fluorophenyl)-3-propan-2-ylpyridazin-4-yl]methanol?
The InChIKey is QYNIPQMAGZEZJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18F2N2O/c1-12(2)19-17(11-25)18(13-3-7-15(21)8-4-13)20(24-23-19)14-5-9-16(22)10-6-14/h3-10,12,25H,11H2,1-2H3.
What are the key properties of [5,6-bis(4-fluorophenyl)-3-propan-2-ylpyridazin-4-yl]methanol?
[5,6-bis(4-fluorophenyl)-3-propan-2-ylpyridazin-4-yl]methanol has a molecular weight of 340.37 g/mol, XLogP of 4.70, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5,6-bis(4-fluorophenyl)-3-propan-2-ylpyridazin-4-yl]methanol is sourced from PubChem (CID 14461247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).