C41H39N — CID 144613777
7,7,9-trimethyl-N-[3-methyl-4-[(2Z,4Z)-6-methylhepta-2,4,6-trienyl]phenyl]-N-phenylbenzo[c]fluoren-5-amine (PubChem CID 144613777) has the molecular formula C41H39N and a molecular weight of 545.77 g/mol. Its IUPAC name is 7,7,9-trimethyl-N-[3-methyl-4-[(2Z,4Z)-6-methylhepta-2,4,6-trienyl]phenyl]-N-phenylbenzo[c]fluoren-5-amine.
| Compound Name | 7,7,9-trimethyl-N-[3-methyl-4-[(2Z,4Z)-6-methylhepta-2,4,6-trienyl]phenyl]-N-phenylbenzo[c]fluoren-5-amine |
|---|---|
| PubChem CID | 144613777 |
| Molecular Formula | C41H39N |
| Molecular Weight | 545.77 g/mol |
| Exact Mass | 545.31 |
| IUPAC Name | 7,7,9-trimethyl-N-[3-methyl-4-[(2Z,4Z)-6-methylhepta-2,4,6-trienyl]phenyl]-N-phenylbenzo[c]fluoren-5-amine |
| SMILES | C=C(C)/C=C\C=C/Cc1ccc(N(c2ccccc2)c2cc3c(c4ccccc24)-c2ccc(C)cc2C3(C)C)cc1C |
| InChI | InChI=1S/C41H39N/c1-28(2)15-9-7-10-16-31-22-23-33(26-30(31)4)42(32-17-11-8-12-18-32)39-27-38-40(35-20-14-13-19-34(35)39)36-24-21-29(3)25-37(36)41(38,5)6/h7-15,17-27H,1,16H2,2-6H3/b10-7-,15-9- |
| InChIKey | CIBNPWDEROHXKR-IVXGHESWSA-N |
| XLogP | 11.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.77 |
| LogP ≤ 5 | 11.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|