About [(3Z,5E,6E)-5-ethylidene-2H-azocin-6-yl]methanamine
[(3Z,5E,6E)-5-ethylidene-2H-azocin-6-yl]methanamine (PubChem CID 144614900) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is [(3Z,5E,6E)-5-ethylidene-2H-azocin-6-yl]methanamine.
Molecular Properties
| Compound Name | [(3Z,5E,6E)-5-ethylidene-2H-azocin-6-yl]methanamine |
| PubChem CID | 144614900 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | [(3Z,5E,6E)-5-ethylidene-2H-azocin-6-yl]methanamine |
| SMILES | C/C=C1\C=C/C/N=C/C=C\1CN |
| InChI | InChI=1S/C10H14N2/c1-2-9-4-3-6-12-7-5-10(9)8-11/h2-5,7H,6,8,11H2,1H3/b4-3-,9-2+,10-5-,12-7- |
| InChIKey | WILGDHZYSFEREM-LDPRAYFWSA-N |
| XLogP | 1.46 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(3Z,5E,6E)-5-ethylidene-2H-azocin-6-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3Z,5E,6E)-5-ethylidene-2H-azocin-6-yl]methanamine?
The IUPAC name of [(3Z,5E,6E)-5-ethylidene-2H-azocin-6-yl]methanamine (CID 144614900) is [(3Z,5E,6E)-5-ethylidene-2H-azocin-6-yl]methanamine.
What is the SMILES notation for [(3Z,5E,6E)-5-ethylidene-2H-azocin-6-yl]methanamine?
The canonical SMILES for [(3Z,5E,6E)-5-ethylidene-2H-azocin-6-yl]methanamine is C/C=C1\C=C/C/N=C/C=C\1CN.
What is the InChIKey of [(3Z,5E,6E)-5-ethylidene-2H-azocin-6-yl]methanamine?
The InChIKey is WILGDHZYSFEREM-LDPRAYFWSA-N. The full InChI is InChI=1S/C10H14N2/c1-2-9-4-3-6-12-7-5-10(9)8-11/h2-5,7H,6,8,11H2,1H3/b4-3-,9-2+,10-5-,12-7-.
What are the key properties of [(3Z,5E,6E)-5-ethylidene-2H-azocin-6-yl]methanamine?
[(3Z,5E,6E)-5-ethylidene-2H-azocin-6-yl]methanamine has a molecular weight of 162.24 g/mol, XLogP of 1.46, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3Z,5E,6E)-5-ethylidene-2H-azocin-6-yl]methanamine is sourced from PubChem (CID 144614900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).