C24H16F3N3S — CID 144615007
1-quinolin-4-yl-N-[4-[2-[6-(trifluoromethyl)-3-pyridinyl]ethynyl]phenyl]sulfanylmethanamine (PubChem CID 144615007) has the molecular formula C24H16F3N3S and a molecular weight of 435.47 g/mol. Its IUPAC name is 1-quinolin-4-yl-N-[4-[2-[6-(trifluoromethyl)-3-pyridinyl]ethynyl]phenyl]sulfanylmethanamine.
| Compound Name | 1-quinolin-4-yl-N-[4-[2-[6-(trifluoromethyl)-3-pyridinyl]ethynyl]phenyl]sulfanylmethanamine |
|---|---|
| PubChem CID | 144615007 |
| Molecular Formula | C24H16F3N3S |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 1-quinolin-4-yl-N-[4-[2-[6-(trifluoromethyl)-3-pyridinyl]ethynyl]phenyl]sulfanylmethanamine |
| SMILES | FC(F)(F)c1ccc(C#Cc2ccc(SNCc3ccnc4ccccc34)cc2)cn1 |
| InChI | InChI=1S/C24H16F3N3S/c25-24(26,27)23-12-9-18(15-29-23)6-5-17-7-10-20(11-8-17)31-30-16-19-13-14-28-22-4-2-1-3-21(19)22/h1-4,7-15,30H,16H2 |
| InChIKey | ZOXWHNBLDSFMFH-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|