C28H42F3N5O2 — CID 144615086
acetaldehyde;(4R)-N-(5,7-dimethylcyclohepta-1,4,6-trien-1-yl)-4-[5-(4,4-dimethylpentyl)-4-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-1-methylpyrrolidine-3-carboxamide (PubChem CID 144615086) has the molecular formula C28H42F3N5O2 and a molecular weight of 537.67 g/mol. Its IUPAC name is acetaldehyde;(4R)-N-(5,7-dimethylcyclohepta-1,4,6-trien-1-yl)-4-[5-(4,4-dimethylpentyl)-4-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-1-methylpyrrolidine-3-carboxamide.
| Compound Name | acetaldehyde;(4R)-N-(5,7-dimethylcyclohepta-1,4,6-trien-1-yl)-4-[5-(4,4-dimethylpentyl)-4-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-1-methylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 144615086 |
| Molecular Formula | C28H42F3N5O2 |
| Molecular Weight | 537.67 g/mol |
| Exact Mass | 537.33 |
| IUPAC Name | acetaldehyde;(4R)-N-(5,7-dimethylcyclohepta-1,4,6-trien-1-yl)-4-[5-(4,4-dimethylpentyl)-4-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-1-methylpyrrolidine-3-carboxamide |
| SMILES | CC1=CCC=C(NC(=O)C2CN(C)C[C@@H]2c2nnc(CCCC(C)(C)C)n2CC(F)(F)F)C(C)=C1.CC=O |
| InChI | InChI=1S/C26H38F3N5O.C2H4O/c1-17-9-7-10-21(18(2)13-17)30-24(35)20-15-33(6)14-19(20)23-32-31-22(11-8-12-25(3,4)5)34(23)16-26(27,28)29;1-2-3/h9-10,13,19-20H,7-8,11-12,14-16H2,1-6H3,(H,30,35);2H,1H3/t19-,20?;/m0./s1 |
| InChIKey | QZEVUQKJZDXEAF-CQLADDOKSA-N |
| XLogP | 5.36 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.67 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|