About 3-[5-(3-methylpentyl)-4-propan-2-yl-1,2,4-triazol-3-yl]propanal
3-[5-(3-methylpentyl)-4-propan-2-yl-1,2,4-triazol-3-yl]propanal (PubChem CID 144615328) has the molecular formula C14H25N3O
and a molecular weight of 251.37 g/mol. Its IUPAC name is 3-[5-(3-methylpentyl)-4-propan-2-yl-1,2,4-triazol-3-yl]propanal.
Molecular Properties
| Compound Name | 3-[5-(3-methylpentyl)-4-propan-2-yl-1,2,4-triazol-3-yl]propanal |
| PubChem CID | 144615328 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | 3-[5-(3-methylpentyl)-4-propan-2-yl-1,2,4-triazol-3-yl]propanal |
| SMILES | CCC(C)CCc1nnc(CCC=O)n1C(C)C |
| InChI | InChI=1S/C14H25N3O/c1-5-12(4)8-9-14-16-15-13(7-6-10-18)17(14)11(2)3/h10-12H,5-9H2,1-4H3 |
| InChIKey | HGPXCGVQVIIDAL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-[5-(3-methylpentyl)-4-propan-2-yl-1,2,4-triazol-3-yl]propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(3-methylpentyl)-4-propan-2-yl-1,2,4-triazol-3-yl]propanal?
The IUPAC name of 3-[5-(3-methylpentyl)-4-propan-2-yl-1,2,4-triazol-3-yl]propanal (CID 144615328) is 3-[5-(3-methylpentyl)-4-propan-2-yl-1,2,4-triazol-3-yl]propanal.
What is the SMILES notation for 3-[5-(3-methylpentyl)-4-propan-2-yl-1,2,4-triazol-3-yl]propanal?
The canonical SMILES for 3-[5-(3-methylpentyl)-4-propan-2-yl-1,2,4-triazol-3-yl]propanal is CCC(C)CCc1nnc(CCC=O)n1C(C)C.
What is the InChIKey of 3-[5-(3-methylpentyl)-4-propan-2-yl-1,2,4-triazol-3-yl]propanal?
The InChIKey is HGPXCGVQVIIDAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N3O/c1-5-12(4)8-9-14-16-15-13(7-6-10-18)17(14)11(2)3/h10-12H,5-9H2,1-4H3.
What are the key properties of 3-[5-(3-methylpentyl)-4-propan-2-yl-1,2,4-triazol-3-yl]propanal?
3-[5-(3-methylpentyl)-4-propan-2-yl-1,2,4-triazol-3-yl]propanal has a molecular weight of 251.37 g/mol, XLogP of 2.97, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(3-methylpentyl)-4-propan-2-yl-1,2,4-triazol-3-yl]propanal is sourced from PubChem (CID 144615328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).