C30H50N4O2 — CID 144615443
3-[4-cyclopropyl-5-[3-(2-methylpropyl)cyclobutyl]-1,2,4-triazol-3-yl]-N-[(1E,3Z)-4,6-dimethylhepta-1,3,5-trienyl]-5-hydroxy-2-methylpentanamide;ethane (PubChem CID 144615443) has the molecular formula C30H50N4O2 and a molecular weight of 498.76 g/mol. Its IUPAC name is 3-[4-cyclopropyl-5-[3-(2-methylpropyl)cyclobutyl]-1,2,4-triazol-3-yl]-N-[(1E,3Z)-4,6-dimethylhepta-1,3,5-trienyl]-5-hydroxy-2-methylpentanamide;ethane.
| Compound Name | 3-[4-cyclopropyl-5-[3-(2-methylpropyl)cyclobutyl]-1,2,4-triazol-3-yl]-N-[(1E,3Z)-4,6-dimethylhepta-1,3,5-trienyl]-5-hydroxy-2-methylpentanamide;ethane |
|---|---|
| PubChem CID | 144615443 |
| Molecular Formula | C30H50N4O2 |
| Molecular Weight | 498.76 g/mol |
| Exact Mass | 498.39 |
| IUPAC Name | 3-[4-cyclopropyl-5-[3-(2-methylpropyl)cyclobutyl]-1,2,4-triazol-3-yl]-N-[(1E,3Z)-4,6-dimethylhepta-1,3,5-trienyl]-5-hydroxy-2-methylpentanamide;ethane |
| SMILES | CC.CC(C)=C/C(C)=C\C=C\NC(=O)C(C)C(CCO)c1nnc(C2CC(CC(C)C)C2)n1C1CC1 |
| InChI | InChI=1S/C28H44N4O2.C2H6/c1-18(2)14-20(5)8-7-12-29-28(34)21(6)25(11-13-33)27-31-30-26(32(27)24-9-10-24)23-16-22(17-23)15-19(3)4;1-2/h7-8,12,14,19,21-25,33H,9-11,13,15-17H2,1-6H3,(H,29,34);1-2H3/b12-7+,20-8-; |
| InChIKey | SKVWCHFZOVRQAM-JSVTUEIMSA-N |
| XLogP | 6.82 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.76 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|